884494-81-9 Usage
Description
3-Bromo-5-fluoro-2-methoxypyridine is an organic compound characterized by the presence of a bromine atom at the 3-position, a fluorine atom at the 5-position, and a methoxy group at the 2-position on a pyridine ring. This unique molecular structure endows it with specific chemical properties that make it a valuable intermediate in the synthesis of various pharmaceutical compounds.
Uses
Used in Pharmaceutical Synthesis:
3-Bromo-5-fluoro-2-methoxypyridine is used as a key intermediate in the synthesis of 5-Fluoro-2-methoxy-3-(2R)-2-pyrrolidinylpyridine (1213093-30-1), a compound with potential therapeutic applications. Its unique structure allows for the development of new drugs with improved efficacy and selectivity, contributing to advancements in medicinal chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 884494-81-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,4,4,9 and 4 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 884494-81:
(8*8)+(7*8)+(6*4)+(5*4)+(4*9)+(3*4)+(2*8)+(1*1)=229
229 % 10 = 9
So 884494-81-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H5BrFNO/c1-10-6-5(7)2-4(8)3-9-6/h2-3H,1H3
884494-81-9Relevant articles and documents
Synthesis process of 2-methoxy-3-bromo-5-fluoropyridine
-
, (2021/03/06)
The invention discloses a synthesis process of 2-methoxy-3-bromo-5-fluoropyridine, which comprises the following steps: dissolving 2-methoxy-5-aminopyridine in an acid, adding nitrous acid or nitriteto prepare a diazotized intermediate state, reacting with a fluorinating reagent to obtain 2-methoxy-5-fluoropyridine, and carrying out a bromination reaction process on 2-methoxy-5-fluoropyridine anda bromination reagent to obtain 2-methoxy-3-bromo-5-fluoropyridine. The synthesis process provided by the invention has the advantages of cheap and easily available raw materials, mild reaction conditions, high yield, easiness in industrial production and the like.