885272-08-2 Usage
Description
5-Amino-1H-indazole-7-carboxylic acid methyl ester is an organic compound that serves as a key intermediate in the synthesis of various pharmaceutical agents. It possesses a unique chemical structure featuring an indazole core with an amino group at the 5-position and a carboxylic acid esterified at the 7-position, which allows for the development of diverse bioactive molecules.
Uses
Used in Pharmaceutical Industry:
5-Amino-1H-indazole-7-carboxylic acid methyl ester is used as a chemical intermediate for the preparation of azabenzimidazoles, which are known as AMPA receptor modulators. These modulators play a crucial role in the treatment of various neurological and neurodegenerative diseases by targeting and modulating the activity of AMPA receptors, which are essential for synaptic transmission and neuronal function.
In the development of novel therapeutic agents, 5-Amino-1H-indazole-7-carboxylic acid methyl ester serves as a building block for the synthesis of potential drugs that can address unmet medical needs and improve patient outcomes. Its versatile chemical structure allows for the design and optimization of molecules with enhanced potency, selectivity, and pharmacokinetic properties, making it a valuable asset in the field of medicinal chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 885272-08-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,5,2,7 and 2 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 885272-08:
(8*8)+(7*8)+(6*5)+(5*2)+(4*7)+(3*2)+(2*0)+(1*8)=202
202 % 10 = 2
So 885272-08-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H9N3O2/c1-14-9(13)7-3-6(10)2-5-4-11-12-8(5)7/h2-4H,10H2,1H3,(H,11,12)
