885275-37-6 Usage
General Description
3-Benzyl-1-phenyl-piperazine dihydrochloride is a chemical compound with potential pharmacological properties. It belongs to the piperazine class of compounds and is an analog of the antipsychotic drug clozapine. 3-BENZYL-1-PHENYL-PIPERAZINE DIHYDROCHLORIDE has been studied for its potential use in treating various neurological disorders, including schizophrenia, through its interactions with dopamine and serotonin receptor systems in the brain. Additionally, it has also been investigated for its potential in inhibiting certain enzymes and as a potential antitumor agent. Further research is needed to fully understand the therapeutic potential and safety profile of 3-benzyl-1-phenyl-piperazine dihydrochloride.
Check Digit Verification of cas no
The CAS Registry Mumber 885275-37-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,5,2,7 and 5 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 885275-37:
(8*8)+(7*8)+(6*5)+(5*2)+(4*7)+(3*5)+(2*3)+(1*7)=216
216 % 10 = 6
So 885275-37-6 is a valid CAS Registry Number.
InChI:InChI=1/C17H20N2.ClH/c1-3-7-15(8-4-1)13-16-14-19(12-11-18-16)17-9-5-2-6-10-17;/h1-10,16,18H,11-14H2;1H
