886362-67-0 Usage
General Description
4,5-Difluoro-2-methylindole-3-carboxylic acid ethyl ester is a chemical compound with a molecular formula of C13H11F2NO2. It is an ester derivative of 4,5-difluoro-2-methylindole-3-carboxylic acid, which is commonly used in the synthesis of pharmaceuticals and agrochemicals. 4,5-DIFLUORO-2-METHYLINDOLE-3-CARBOXYLIC ACID ETHYL ESTER is often used as an intermediate in the production of various drugs and biologically active compounds due to its promising pharmacological properties. Its ester form makes it more soluble in organic solvents, making it easier to handle and use in chemical reactions and processes. Additionally, it is known for its potential applications in the field of medicinal chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 886362-67-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,3,6 and 2 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 886362-67:
(8*8)+(7*8)+(6*6)+(5*3)+(4*6)+(3*2)+(2*6)+(1*7)=220
220 % 10 = 0
So 886362-67-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H11F2NO2/c1-3-17-12(16)9-6(2)15-8-5-4-7(13)11(14)10(8)9/h4-5,15H,3H2,1-2H3
