886362-68-1 Usage
General Description
4-FLUORO-2-METHYLINDOLE-3-CARBOXYLIC ACID ETHYL ESTER is a chemical compound with the molecular formula C12H12FNO2. It is an ester derivative of 4-fluoro-2-methylindole-3-carboxylic acid, and is commonly used as an intermediate in the synthesis of pharmaceuticals and other organic compounds. 4-FLUORO-2-METHYLINDOLE-3-CARBOXYLIC ACID ETHYL ESTER is known for its potential applications in the field of medicinal chemistry, particularly in the development of new drugs and therapeutic agents. Its unique structure and properties make it a valuable building block for the construction of diverse chemical compounds, leading to its significance in the synthesis of various pharmaceutical products.
Check Digit Verification of cas no
The CAS Registry Mumber 886362-68-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,3,6 and 2 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 886362-68:
(8*8)+(7*8)+(6*6)+(5*3)+(4*6)+(3*2)+(2*6)+(1*8)=221
221 % 10 = 1
So 886362-68-1 is a valid CAS Registry Number.
InChI:InChI=1/C12H12FNO2/c1-3-16-12(15)10-7(2)14-9-6-4-5-8(13)11(9)10/h4-6,14H,3H2,1-2H3