886364-07-4 Usage
Description
1-[2-AMINO-1-(4-METHOXY-PHENYL)-ETHYL]-PYRROLIDINE-3-CARBOXYLIC ACID is a pyrrolidine derivative featuring an amino group, a methoxyphenyl group, and a pyrrolidine-3-carboxylic acid group. 1-[2-AMINO-1-(4-METHOXY-PHENYL)-ETHYL]-PYRROLIDINE-3-CARBOXYLIC ACID is of interest in medicine and research due to its potential biological activity, which may include binding to receptors or enzymes within the body. The presence of the methoxyphenyl group suggests possible interactions with other molecules and proteins, making it a promising candidate for further study and drug development.
Uses
Used in Pharmaceutical Industry:
1-[2-AMINO-1-(4-METHOXY-PHENYL)-ETHYL]-PYRROLIDINE-3-CARBOXYLIC ACID is used as a potential pharmaceutical agent for its possible biological activity. The presence of the amino and carboxylic acid groups allows for interactions with receptors or enzymes, which could be harnessed for therapeutic purposes.
Used in Research Applications:
In research, 1-[2-AMINO-1-(4-METHOXY-PHENYL)-ETHYL]-PYRROLIDINE-3-CARBOXYLIC ACID serves as a valuable compound for studying the interactions between molecules and proteins. Its structural features make it an interesting subject for investigations into drug development and understanding its potential effects on biological systems.
Check Digit Verification of cas no
The CAS Registry Mumber 886364-07-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,3,6 and 4 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 886364-07:
(8*8)+(7*8)+(6*6)+(5*3)+(4*6)+(3*4)+(2*0)+(1*7)=214
214 % 10 = 4
So 886364-07-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H20N2O3/c1-19-12-4-2-10(3-5-12)13(8-15)16-7-6-11(9-16)14(17)18/h2-5,11,13H,6-9,15H2,1H3,(H,17,18)
