886851-48-5 Usage
General Description
N-methyl-4-pyrimidin-2-ylbenzylamine is a chemical compound with the molecular formula C14H15N3. It is a derivative of benzylamine and contains a methyl group attached to the nitrogen atom. The compound also features a pyrimidine ring, which is a heterocyclic ring containing nitrogen atoms. N-methyl-4-pyrimidin-2-ylbenzylamine has potential applications in medicinal chemistry and pharmaceutical research due to its structural features, which make it a potential candidate for drug development. Furthermore, its unique chemical structure and properties may also make it suitable for use in various chemical reactions and synthesis processes in the laboratory.
Check Digit Verification of cas no
The CAS Registry Mumber 886851-48-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,8,5 and 1 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 886851-48:
(8*8)+(7*8)+(6*6)+(5*8)+(4*5)+(3*1)+(2*4)+(1*8)=235
235 % 10 = 5
So 886851-48-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H13N3/c1-13-9-10-3-5-11(6-4-10)12-14-7-2-8-15-12/h2-8,13H,9H2,1H3