887594-04-9 Usage
Description
3-(5-BROMO-PYRIDIN-3-YL)-3-OXO-PROPIONITRILE is a chemical compound characterized by its molecular formula C8H5BrN2O. It is a yellow solid that features a 5-bromo-pyridine ring and a propionitrile group, with a carbon triple-bonded to a nitrogen atom. This unique structure and composition make it a valuable component in scientific research and pharmaceutical development.
Uses
Used in Pharmaceutical Development:
3-(5-BROMO-PYRIDIN-3-YL)-3-OXO-PROPIONITRILE is used as a building block for the synthesis of pharmaceuticals and organic compounds. Its distinctive structure and properties contribute to the creation of new drugs and therapeutic agents.
Used in Scientific Research:
In the field of scientific research, 3-(5-BROMO-PYRIDIN-3-YL)-3-OXO-PROPIONITRILE serves as a key component in the study and development of novel chemical compounds. Its unique characteristics facilitate advancements in various areas of chemistry and related disciplines.
Check Digit Verification of cas no
The CAS Registry Mumber 887594-04-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,7,5,9 and 4 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 887594-04:
(8*8)+(7*8)+(6*7)+(5*5)+(4*9)+(3*4)+(2*0)+(1*4)=239
239 % 10 = 9
So 887594-04-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H5BrN2O/c9-7-3-6(4-11-5-7)8(12)1-2-10/h3-5H,1H2
