89123-72-8 Usage
Description
3-Amino-5-chloropyridazin-4-ylamine is a chlorinated pyridazine derivative with the molecular formula C5H5ClN4. It belongs to the class of aminopyridazines and has potential applications in pharmaceutical and agrochemical industries due to its biological activities. This chemical compound is known for its role as an intermediate in the synthesis of various pharmaceutical compounds and agricultural chemicals. Additionally, it has been studied for its potential use as an antitumor agent and in the development of fungicides. Overall, 3-amino-5-chloropyridazin-4-ylamine has a range of potential applications in various fields due to its unique structure and properties.
Uses
Used in Pharmaceutical Industry:
3-Amino-5-chloropyridazin-4-ylamine is used as an intermediate in the synthesis of various pharmaceutical compounds for its potential biological activities.
Used in Agrochemical Industry:
3-Amino-5-chloropyridazin-4-ylamine is used as an intermediate in the development of agricultural chemicals, such as fungicides, due to its potential applications in controlling plant diseases.
Used in Antitumor Applications:
3-Amino-5-chloropyridazin-4-ylamine is studied for its potential use as an antitumor agent, indicating its possible role in the development of cancer treatments.
Used in Drug Synthesis:
3-Amino-5-chloropyridazin-4-ylamine is utilized as a building block in the synthesis of various drug molecules, contributing to the discovery and development of new therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 89123-72-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,1,2 and 3 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 89123-72:
(7*8)+(6*9)+(5*1)+(4*2)+(3*3)+(2*7)+(1*2)=148
148 % 10 = 8
So 89123-72-8 is a valid CAS Registry Number.
InChI:InChI=1/C4H5ClN4/c5-2-1-8-9-4(7)3(2)6/h1H,(H2,6,8)(H2,7,9)
