893615-95-7 Usage
General Description
Ethyl 1-(2,5-dichlorophenyl)-1H-imidazole-5-carboxylate is a chemical compound that belongs to the class of imidazole derivatives. It is commonly used in pharmaceutical and agricultural industries as a building block for the synthesis of various drugs and pesticides. Ethyl 1-(2,5-dichlorophenyl)-1H-imidazole-5-carboxylate has been found to exhibit antimicrobial and antifungal properties, making it an important component in the development of new pharmaceutical products. Its unique molecular structure and reactivity also make it a valuable intermediate in organic synthesis for the preparation of various functionalized compounds. Additionally, it has potential applications in the field of medicinal chemistry for the development of new therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 893615-95-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,3,6,1 and 5 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 893615-95:
(8*8)+(7*9)+(6*3)+(5*6)+(4*1)+(3*5)+(2*9)+(1*5)=217
217 % 10 = 7
So 893615-95-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H10Cl2N2O2/c1-2-18-12(17)11-6-15-7-16(11)10-5-8(13)3-4-9(10)14/h3-7H,2H2,1H3