89614-96-0 Usage
General Description
3-Aminocyclopentanecarboxylic acid is a chemical compound with the molecular formula C6H11NO2. It is a cyclic derivative of the amino acid proline, and is commonly used in the synthesis of pharmaceuticals and other organic compounds. As a proline derivative, 3-aminocyclopentanecarboxylic acid plays a crucial role in the formation of protein structures and is involved in numerous biochemical pathways in living organisms. It is also used as a building block in the production of peptides and other organic molecules, making it an important compound in the field of medicinal chemistry and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 89614-96-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,6,1 and 4 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 89614-96:
(7*8)+(6*9)+(5*6)+(4*1)+(3*4)+(2*9)+(1*6)=180
180 % 10 = 0
So 89614-96-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H11NO2/c7-5-2-1-4(3-5)6(8)9/h4-5H,1-3,7H2,(H,8,9)
