898289-65-1 Usage
Description
4-[(ALLYLOXY)CARBONYL]PIPERAZINE-2-CARBOXYLIC ACID, N1-FMOC PROTECTED 97%4-ALLYL 1-(9-H-FLUOREN-9-YLMETHYL) HYDROGEN PIPERAZINE-1,2,4-TRICARBOXYLATE is a complex organic compound consisting of a piperazine derivative with a carboxylic acid group that is N1-FMOC protected at a 97% purity level and a tricarboxylate derivative of piperazine with an allyl group and a 9-H-fluoren-9-ylmethyl group attached. These compounds are commonly used in organic synthesis and medicinal chemistry for the development of pharmaceutical drugs and other applications.
Uses
Used in Pharmaceutical Industry:
4-[(ALLYLOXY)CARBONYL]PIPERAZINE-2-CARBOXYLIC ACID, N1-FMOC PROTECTED 97%4-ALLYL 1-(9-H-FLUOREN-9-YLMETHYL) HYDROGEN PIPERAZINE-1,2,4-TRICARBOXYLATE is used as a building block for the synthesis of pharmaceutical drugs due to its unique chemical structure and functional groups.
Used in Organic Synthesis:
4-[(ALLYLOXY)CARBONYL]PIPERAZINE-2-CARBOXYLIC ACID, N1-FMOC PROTECTED 97%4-ALLYL 1-(9-H-FLUOREN-9-YLMETHYL) HYDROGEN PIPERAZINE-1,2,4-TRICARBOXYLATE is used as an intermediate in organic synthesis for the preparation of various organic compounds and materials.
Used in Research and Development:
4-[(ALLYLOXY)CARBONYL]PIPERAZINE-2-CARBOXYLIC ACID, N1-FMOC PROTECTED 97%4-ALLYL 1-(9-H-FLUOREN-9-YLMETHYL) HYDROGEN PIPERAZINE-1,2,4-TRICARBOXYLATE is used as a research compound for studying its chemical properties, reactivity, and potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 898289-65-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,2,8 and 9 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 898289-65:
(8*8)+(7*9)+(6*8)+(5*2)+(4*8)+(3*9)+(2*6)+(1*5)=261
261 % 10 = 1
So 898289-65-1 is a valid CAS Registry Number.
InChI:InChI=1/C24H24N2O6/c1-2-13-31-23(29)25-11-12-26(21(14-25)22(27)28)24(30)32-15-20-18-9-5-3-7-16(18)17-8-4-6-10-19(17)20/h2-10,20-21H,1,11-15H2,(H,27,28)