898756-24-6 Usage
Main properties
1. Chemical compound
2. Contains a 2'-fluorobenzophenone core structure
3. Has a 1,4-dioxa-8-azaspiro[4.5]decyl functional group attached to the benzophenone core through a methyl linker
4. Potential applications in pharmaceuticals, agrochemicals, and materials science
5. Unique structural features and potential reactivity
6. Fluorinated benzophenone core may contribute to its photophysical and photochemical properties
7. Potential uses in UV screening and photostabilization applications
8. Further research and analysis needed
Specific content
1. Chemical compound: 2-[8-(1,4-DIOXA-8-AZASPIRO[4.5]DECYL)METHYL]-2'-FLUOROBENZOPHENONE
2. Core structure: 2'-fluorobenzophenone
3. Functional group: 1,4-dioxa-8-azaspiro[4.5]decyl
4. Linker: methyl
5. Applications: pharmaceuticals, agrochemicals, materials science
6. Potential properties: photophysical, photochemical
7. Uses: UV screening, photostabilization
Check Digit Verification of cas no
The CAS Registry Mumber 898756-24-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,5 and 6 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 898756-24:
(8*8)+(7*9)+(6*8)+(5*7)+(4*5)+(3*6)+(2*2)+(1*4)=256
256 % 10 = 6
So 898756-24-6 is a valid CAS Registry Number.
InChI:InChI=1/C21H22FNO3/c22-19-8-4-3-7-18(19)20(24)17-6-2-1-5-16(17)15-23-11-9-21(10-12-23)25-13-14-26-21/h1-8H,9-15H2