898780-24-0 Usage
Type of compound
Benzoylpyridine derivative
Usage
Synthesis of various pharmaceuticals and agrochemicals
Potential applications
Development of new drugs due to ability to modulate various biological processes
Utilization
Organic chemistry as a building block for the synthesis of more complex compounds
Unique structure and properties
Valuable tool for researchers and scientists in the development of new materials and drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 898780-24-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,8 and 0 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 898780-24:
(8*8)+(7*9)+(6*8)+(5*7)+(4*8)+(3*0)+(2*2)+(1*4)=250
250 % 10 = 0
So 898780-24-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H7F2NO/c13-8-4-3-5-9(14)11(8)12(16)10-6-1-2-7-15-10/h1-7H
