902837-16-5 Usage
General Description
1-(3-Methoxypyridin-2-yl)piperidin-4-amine is a chemical compound that contains a piperidine ring with a substituted pyridine group attached to it. The piperidine ring is a heterocyclic organic compound, while the pyridine group is a six-membered aromatic ring with one nitrogen atom. 1-(3-METHOXYPYRIDIN-2-YL)PIPERIDIN-4-AMINE is classified as an amine due to the presence of an amino group (-NH2) attached to the piperidine ring. The methoxy group (CH3O-) on the pyridine ring indicates the presence of a methoxy functional group, which consists of a methyl group bound to an oxygen atom. This chemical compound may have various applications in the pharmaceutical industry, potentially as a building block for the synthesis of other organic compounds or as a drug candidate for various medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 902837-16-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,2,8,3 and 7 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 902837-16:
(8*9)+(7*0)+(6*2)+(5*8)+(4*3)+(3*7)+(2*1)+(1*6)=165
165 % 10 = 5
So 902837-16-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H17N3O/c1-15-10-3-2-6-13-11(10)14-7-4-9(12)5-8-14/h2-3,6,9H,4-5,7-8,12H2,1H3
