902837-40-5 Usage
Description
6-Bromo-2-chloro-1,8-naphthyridine is an organic compound that serves as a key building block in the synthesis of various pharmaceutical intermediates. Its unique structure, featuring a naphthyridine core with a bromine and chlorine substituent, makes it a versatile and valuable component in the development of new drugs and therapeutic agents.
Uses
Used in Pharmaceutical Industry:
6-Bromo-2-chloro-1,8-naphthyridine is used as a raw material for the synthesis of pharmaceutical intermediates. Its presence in the molecular structure of these intermediates allows for the development of new drugs with potential therapeutic applications, such as antibiotics, antiviral agents, and other medications that target specific biological pathways or diseases.
In the synthesis process, 6-bromo-2-chloro-1,8-naphthyridine can be further modified or combined with other chemical entities to create more complex molecules with desired pharmacological properties. This makes it an essential component in the ongoing research and development of novel pharmaceuticals, contributing to the advancement of medicine and healthcare.
Check Digit Verification of cas no
The CAS Registry Mumber 902837-40-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,2,8,3 and 7 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 902837-40:
(8*9)+(7*0)+(6*2)+(5*8)+(4*3)+(3*7)+(2*4)+(1*0)=165
165 % 10 = 5
So 902837-40-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H4BrClN2/c9-7-2-1-5-3-6(10)4-11-8(5)12-7/h1-4H
