90559-98-1 Usage
General Description
ETHYL 7-AMINO-2-(METHYLTHIO)[1,2,4]TRIAZOLO[1,5-A]PYRIMIDINE-6-CARBOXYLATE is a chemical compound with a complex structure. It contains an ethyl group, an amino group, a methylthio group, and a carboxylate group. The compound is also composed of a triazolo ring and a pyrimidine ring, giving it unique chemical properties. It may have potential applications in pharmaceuticals, agrochemicals, or material science due to its structural characteristics and potential biological activities. Further research may be needed to fully understand the properties and potential uses of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 90559-98-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,5,5 and 9 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 90559-98:
(7*9)+(6*0)+(5*5)+(4*5)+(3*9)+(2*9)+(1*8)=161
161 % 10 = 1
So 90559-98-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H11N5O2S/c1-3-16-7(15)5-4-11-8-12-9(17-2)13-14(8)6(5)10/h4H,3,10H2,1-2H3
