905827-27-2 Usage
General Description
L-Ascorbic acid diphenylmethanamine is a compound that combines L-ascorbic acid (also known as vitamin C) with diphenylmethanamine. L-ascorbic acid is a water-soluble vitamin that acts as an antioxidant, helping to protect cells from damage caused by free radicals. It also plays a crucial role in collagen synthesis and is essential for maintaining healthy skin, bones, and blood vessels. Diphenylmethanamine, on the other hand, is a type of aromatic amine that is often used as an intermediate in the synthesis of other chemicals. When combined with L-ascorbic acid, it is likely that the resulting compound may have antioxidant and skin-brightening properties, making it potentially useful in cosmetics and skincare products. However, further research is needed to fully understand the potential benefits and safety of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 905827-27-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,5,8,2 and 7 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 905827-27:
(8*9)+(7*0)+(6*5)+(5*8)+(4*2)+(3*7)+(2*2)+(1*7)=182
182 % 10 = 2
So 905827-27-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H13N.C6H8O6/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;7-1-2(8)5-3(9)4(10)6(11)12-5/h1-10,13H,14H2;2,5,7-10H,1H2/t;2-,5+/m.0/s1
