912569-54-1 Usage
Description
2-(Tetrahydropyran-4-yloxy)pyridin-5-yl isocyanate is a chemical compound with the molecular formula C12H14N2O3. It is an isocyanate derivative that features a tetrahydropyran-4-yloxy substituent on the pyridine ring. 2-(Tetrahydropyran-4-yloxy)pyridin-5-yl isocyanate is known for its reactivity and potential applications in various industries.
Uses
Used in Pharmaceutical Industry:
2-(Tetrahydropyran-4-yloxy)pyridin-5-yl isocyanate is used as a building block in the synthesis of pharmaceuticals due to its unique structure and reactivity. The presence of the pyridine group and the tetrahydropyran-4-yloxy substituent may contribute to the development of new drugs with enhanced properties.
Used in Agrochemical Industry:
2-(Tetrahydropyran-4-yloxy)pyridin-5-yl isocyanate is used as an intermediate in the production of agrochemicals, such as pesticides and herbicides. Its reactivity and structural features make it a promising candidate for the development of novel and effective agrochemicals.
Used in Polymer Industry:
2-(Tetrahydropyran-4-yloxy)pyridin-5-yl isocyanate is used as a monomer in the production of polyurethane foams, coatings, and adhesives. Its reactivity allows for the formation of versatile polymers with a range of properties, making it a valuable component in the polymer industry.
Further research is needed to explore the potential uses and properties of 2-(Tetrahydropyran-4-yloxy)pyridin-5-yl isocyanate, as its unique structure and reactivity may lead to new applications and advancements in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 912569-54-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,2,5,6 and 9 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 912569-54:
(8*9)+(7*1)+(6*2)+(5*5)+(4*6)+(3*9)+(2*5)+(1*4)=181
181 % 10 = 1
So 912569-54-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H12N2O3/c14-8-13-9-1-2-11(12-7-9)16-10-3-5-15-6-4-10/h1-2,7,10H,3-6H2