912635-70-2 Usage
Chemical compound
A substance formed by a chemical reaction and having a definite composition and distinct properties.
Complex molecular structure
The compound has a complex arrangement of atoms and bonds in its molecular structure.
Pyrazole derivative
It is a chemical compound derived from the parent compound pyrazole, which is a five-membered heterocyclic ring containing four carbon atoms and one nitrogen atom.
Carboxylic acid functional group
The compound contains a carboxylic acid functional group, which is a carboxyl group (-COOH) attached to a carbon atom.
Potential applications
The compound may have potential applications in the field of medicinal chemistry.
Pharmacological properties
The compound has been studied for its pharmacological properties, which are the interactions between the compound and living organisms, including their effects on biological systems.
Thiopyran ring
The compound contains a thiopyran ring in its structure, which is a six-membered ring containing one sulfur atom and five carbon atoms.
Unique chemical and biological properties
The presence of the thiopyran ring may contribute to the compound's unique chemical and biological properties.
Further research needed
More research is required to fully understand the potential uses and effects of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 912635-70-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,2,6,3 and 5 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 912635-70:
(8*9)+(7*1)+(6*2)+(5*6)+(4*3)+(3*5)+(2*7)+(1*0)=162
162 % 10 = 2
So 912635-70-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O2S/c10-7(11)6-4-3-12-2-1-5(4)8-9-6/h1-3H2,(H,8,9)(H,10,11)
