913830-33-8 Usage
Description
4-Methylhomopiperazine-4-aminobenzene trihydrochloride monohydrate is a chemical compound consisting of 4-methylhomopiperazine, 4-aminobenzene, hydrochloric acid, and a monohydrate molecule, which is associated with each molecule of the compound. Its unique structure and properties make it a valuable component in the pharmaceutical industry for the synthesis of various drugs and medications.
Used in Pharmaceutical Industry:
4-Methylhomopiperazine-4-aminobenzene trihydrochloride monohydrate is used as a key component in the synthesis of various drugs and medications for treating a wide range of medical conditions. Its unique structure and properties contribute to the development of effective treatments and therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 913830-33-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,3,8,3 and 0 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 913830-33:
(8*9)+(7*1)+(6*3)+(5*8)+(4*3)+(3*0)+(2*3)+(1*3)=158
158 % 10 = 8
So 913830-33-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H19N3.3ClH.H2O/c1-14-7-2-8-15(10-9-14)12-5-3-11(13)4-6-12;;;;/h3-6H,2,7-10,13H2,1H3;3*1H;1H2
