913835-92-4 Usage
Description
2-CHLORO-5-(METHOXYCARBONYL)BENZENEBORONIC ACID 98 is a boronic acid derivative characterized by the presence of a chloro and a methoxycarbonyl group attached to the benzene ring. It is a versatile building block in organic synthesis and has potential applications in various chemical reactions.
Uses
Used in Metal-Catalyzed Cross-Coupling Reactions:
2-CHLORO-5-(METHOXYCARBONYL)BENZENEBORONIC ACID 98 is used as a coupling partner in metal-catalyzed cross-coupling reactions for the formation of C-C and C-N bonds. It is particularly useful in the Suzuki-Miyaura coupling, which allows for the coupling of boronic acids with carbon halides and surrogates.
Used in 1,4-Addition Reactions:
In the field of organic synthesis, 2-CHLORO-5-(METHOXYCARBONYL)BENZENEBORONIC ACID 98 is used as a reagent in 1,4-addition reactions to activated alkenes, a,?-unsaturated ketones, esters, and amides. This allows for the formation of new carbon-carbon bonds and the synthesis of more complex molecules.
Used in 1,2-Addition Reactions:
2-CHLORO-5-(METHOXYCARBONYL)BENZENEBORONIC ACID 98 is also employed in 1,2-addition reactions to carbonyls and imines, enabling the formation of new carbon-heteroatom bonds and the synthesis of various heterocyclic compounds.
Used in Addition to Anhydrides:
In organic chemistry, 2-CHLORO-5-(METHOXYCARBONYL)BENZENEBORONIC ACID 98 is used as a reagent in the addition to anhydrides, leading to the formation of carboxylic acid derivatives and other valuable intermediates in the synthesis of pharmaceuticals and agrochemicals.
Overall, 2-CHLORO-5-(METHOXYCARBONYL)BENZENEBORONIC ACID 98 is a valuable building block in organic synthesis, with applications in various chemical reactions, including metal-catalyzed cross-coupling, 1,4-addition, 1,2-addition, and addition to anhydrides. Its versatility makes it a useful compound in the synthesis of complex organic molecules and the development of new pharmaceuticals and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 913835-92-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,3,8,3 and 5 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 913835-92:
(8*9)+(7*1)+(6*3)+(5*8)+(4*3)+(3*5)+(2*9)+(1*2)=184
184 % 10 = 4
So 913835-92-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H8BClO4/c1-14-8(11)5-2-3-7(10)6(4-5)9(12)13/h2-4,12-13H,1H3
