913836-11-0 Usage
General Description
5-Boronopicolinic acid is a chemical compound containing boron, nitrogen, carbon, and oxygen. It is a derivative of picolinic acid and is commonly used as a ligand in coordination chemistry and as a precursor to various functionalized materials. It is a versatile building block for the synthesis of heterocyclic compounds, and its boron atom can participate in various catalytic reactions. This chemical has applications in the pharmaceutical industry, in the development of new drugs and in academic research as a tool for organic synthesis and coordination chemistry studies. Its unique structure and properties make it a valuable and versatile compound in various chemical and pharmaceutical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 913836-11-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,3,8,3 and 6 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 913836-11:
(8*9)+(7*1)+(6*3)+(5*8)+(4*3)+(3*6)+(2*1)+(1*1)=170
170 % 10 = 0
So 913836-11-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H6BNO4/c9-6(10)5-2-1-4(3-8-5)7(11)12/h1-3,11-12H,(H,9,10)