915707-60-7 Usage
Description
2-(3-bromophenoxy)-6-methylpyrazine is a pyrazine derivative with the molecular formula C12H10BrN3O. It features a bromophenoxy group at the 2-position and a methyl group at the 6-position of the pyrazine ring. This chemical compound is known for its potential biological activities and is utilized in various industries, including pharmaceutical and agricultural sectors, as well as in research and development.
Uses
Used in Pharmaceutical Industry:
2-(3-bromophenoxy)-6-methylpyrazine is used as a chemical intermediate for the synthesis of various organic compounds and pharmaceuticals. Its unique structure and properties contribute to the development of new drugs with potential therapeutic applications.
Used in Agricultural Industry:
In agriculture, 2-(3-bromophenoxy)-6-methylpyrazine is used as an antimicrobial, insecticidal, and antifungal agent. Its biological activities help protect crops from various pests and diseases, thereby enhancing crop yield and quality.
Used in Research and Development:
2-(3-bromophenoxy)-6-methylpyrazine is utilized in research and development for studying its potential biological activities and exploring its applications in various fields. Its unique structure makes it a valuable component in the synthesis of new chemical compounds and intermediates.
Check Digit Verification of cas no
The CAS Registry Mumber 915707-60-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,5,7,0 and 7 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 915707-60:
(8*9)+(7*1)+(6*5)+(5*7)+(4*0)+(3*7)+(2*6)+(1*0)=177
177 % 10 = 7
So 915707-60-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H9BrN2O/c1-8-6-13-7-11(14-8)15-10-4-2-3-9(12)5-10/h2-7H,1H3
