915707-63-0 Usage
Description
4-[(6-methylpyrazin-2-yl)oxy]aniline is a chemical compound with the molecular formula C11H11N3O. It is composed of a pyrazine ring substituted with a methyl group and an aniline group. 4-[(6-methylpyrazin-2-yl)oxy]aniline is known for its versatility in chemical synthesis and its potential applications in various fields.
Uses
Used in Pharmaceutical Synthesis:
4-[(6-methylpyrazin-2-yl)oxy]aniline is used as a building block in the synthesis of pharmaceuticals. Its unique structure allows it to be a key component in the development of new drugs with specific therapeutic properties.
Used in Organic Compounds Synthesis:
In the field of organic chemistry, 4-[(6-methylpyrazin-2-yl)oxy]aniline is used as a reagent for synthesizing a variety of organic compounds. Its ability to form different chemical entities makes it valuable for creating complex organic molecules.
Used in Dyes and Pigments Production:
4-[(6-methylpyrazin-2-yl)oxy]aniline is utilized as a precursor in the production of dyes and pigments. Its chemical structure contributes to the color and stability of these products, making it an important component in the manufacturing process.
Used in Research and Development:
In research settings, 4-[(6-methylpyrazin-2-yl)oxy]aniline serves as a precursor to other compounds with specific properties and functions. Its potential to create new chemical entities with biological activity makes it a valuable tool for scientific exploration and innovation.
Check Digit Verification of cas no
The CAS Registry Mumber 915707-63-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,5,7,0 and 7 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 915707-63:
(8*9)+(7*1)+(6*5)+(5*7)+(4*0)+(3*7)+(2*6)+(1*3)=180
180 % 10 = 0
So 915707-63-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H11N3O/c1-8-6-13-7-11(14-8)15-10-4-2-9(12)3-5-10/h2-7H,12H2,1H3
