916791-08-7 Usage
General Description
1-(4-chloro-pyrimidin-2-yl)-piperidin-4-ol, also known as a chloropyrimidinylpiperidinol compound, is a chemical compound with a molecular formula C10H14ClN3O. It is a pyrimidine derivative with a piperidinol moiety, making it a heterocyclic compound. This chemical is commonly used in pharmaceutical research as a building block for the synthesis of various drugs and biologically active compounds. Its structure and properties make it a versatile intermediate in organic synthesis, allowing for the creation of diverse chemical structures with potential therapeutic applications. The chloropyrimidinylpiperidinol compound is of interest to medicinal chemists due to its potential pharmacological properties and its ability to interact with biological systems in a specific and controlled manner.
Check Digit Verification of cas no
The CAS Registry Mumber 916791-08-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,6,7,9 and 1 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 916791-08:
(8*9)+(7*1)+(6*6)+(5*7)+(4*9)+(3*1)+(2*0)+(1*8)=197
197 % 10 = 7
So 916791-08-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H12ClN3O/c10-8-1-4-11-9(12-8)13-5-2-7(14)3-6-13/h1,4,7,14H,2-3,5-6H2