924296-17-3 Usage
Description
9H-Indeno[1,2-b]pyrazine-2,3-dicarbonitrile, 9-[(2-propen-1-yloxy)imino]is a chemical compound with the molecular formula C22H10N6O. It is a pyrazine derivative with two carbonitrile groups and an imino group attached to an indeno ring. 9H-Indeno[1,2-b]pyrazine-2,3-dicarbonitrile, 9-[(2-propen-1-yloxy)imino]has a unique structure and reactivity, making it a promising candidate for various applications in organic synthesis, pharmaceuticals, and materials science.
Uses
Used in Organic Synthesis:
9H-Indeno[1,2-b]pyrazine-2,3-dicarbonitrile, 9-[(2-propen-1-yloxy)imino]is used as a building block in the synthesis of new organic compounds. Its unique structure and reactivity allow for the creation of novel organic molecules with specific properties.
Used in Pharmaceutical Industry:
9H-Indeno[1,2-b]pyrazine-2,3-dicarbonitrile, 9-[(2-propen-1-yloxy)imino]is used as a precursor for the development of novel pharmaceuticals. Its unique chemical properties may contribute to the discovery of new drugs with improved efficacy and reduced side effects.
Used in Materials Science:
9H-Indeno[1,2-b]pyrazine-2,3-dicarbonitrile, 9-[(2-propen-1-yloxy)imino]is used in the development of new materials with specific properties. Its unique structure and reactivity can be leveraged to create materials with tailored characteristics for various applications.
9H-Indeno[1,2-b]pyrazine-2,3-dicarbonitrile, 9-[(2-propen-1-yloxy)imino]is a subject of interest for further research and development due to its potential applications and chemical properties. Its unique structure and reactivity make it a valuable compound for exploration in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 924296-17-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,2,4,2,9 and 6 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 924296-17:
(8*9)+(7*2)+(6*4)+(5*2)+(4*9)+(3*6)+(2*1)+(1*7)=183
183 % 10 = 3
So 924296-17-3 is a valid CAS Registry Number.
InChI:InChI=1/C16H9N5O/c1-2-7-22-21-15-11-6-4-3-5-10(11)14-16(15)20-13(9-18)12(8-17)19-14/h2-6H,1,7H2
924296-17-3Relevant articles and documents
Synthesis and biological evaluation of 9-oxo-9hindeno[1,2-b]pyrazine-2,3- dicarbonitrile analogues as potential inhibitors of deubiquitinating enzymes
Colombo, Matteo,Vallese, Stefania,Peretto, Ilaria,Jacq, Xavier,Rain, Jean-Christophe,Colland, Frederic,Guedat, Philippe
experimental part, p. 552 - 558 (2010/12/25)
High-throughput screening highlighted 9-oxo-9H-indeno[1,2-b]pyrazine-2,3- dicarbonitrile (1) as an active inhibitor of ubiquitin-specific proteases (USPs), a family of hydrolytic enzymes involved in the removal of ubiquitin from protein substrates. The chemical behavior of compound 1 was examined. Moreover, the synthesis and in vitro evaluation of new compounds, analogues of 1, led to the identification of potent and selective inhibitors of the deubiquitinating enzyme USP8.
Novel cysteine protease inhibitors and their therapeutic applications
-
Page/Page column 16, (2008/06/13)
The present invention concerns new compounds of formula (I), their process of preparation and their therapeutic use.
