93107-30-3 Usage
Description
1-Cyclopropyl-6,7-difluoro-1,4-dihydro-4-oxoquinoline-3-carboxylic acid is a chemical compound that serves as a metabolite of Moxifloxacin (M745000). It is characterized by its cyclopropyl group, difluoro substitution, and quinoline core, which contribute to its unique chemical properties and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
1-Cyclopropyl-6,7-difluoro-1,4-dihydro-4-oxoquinoline-3-carboxylic acid is used as a key intermediate in the synthesis of chiral aminopiperidinyl quinolones. These quinolones are potent antibacterial agents that are effective against resistant pathogens, making them valuable in the development of new antibiotics to combat drug-resistant infections.
Additionally, as a metabolite of Moxifloxacin, it may also contribute to the overall efficacy and safety profile of the parent compound, which is a widely used fluoroquinolone antibiotic. Further research and development in this area could lead to improved treatments and therapies for bacterial infections.
Check Digit Verification of cas no
The CAS Registry Mumber 93107-30-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,1,0 and 7 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 93107-30:
(7*9)+(6*3)+(5*1)+(4*0)+(3*7)+(2*3)+(1*0)=113
113 % 10 = 3
So 93107-30-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H9F2NO3/c14-9-3-7-11(4-10(9)15)16(6-1-2-6)5-8(12(7)17)13(18)19/h3-6H,1-2H2,(H,18,19)
