93776-98-8 Usage
Description
3,4-Dihydro-6,7,8-trimethoxy-2-methylisoquinolinium methyl sulphate is a quaternary ammonium salt derived from isoquinoline, featuring a methyl sulphate group and a unique molecular structure with a quaternary carbon center, three methoxy groups, and a methyl group attached to an isoquinoline core. It is notably water-soluble and can form stable solutions in various solvents, making it a valuable compound for laboratory research and pharmaceutical applications.
Uses
Used in Laboratory Research:
3,4-Dihydro-6,7,8-trimethoxy-2-methylisoquinolinium methyl sulphate is used as a reagent in laboratory research for its water solubility and ability to form stable solutions in various solvents, facilitating a wide range of biochemical studies and experiments.
Used in Pharmaceutical Applications:
In the pharmaceutical industry, 3,4-Dihydro-6,7,8-trimethoxy-2-methylisoquinolinium methyl sulphate is utilized for its potential role in the development of new drugs and therapeutic agents, capitalizing on its unique chemical properties and interactions with biological systems.
Check Digit Verification of cas no
The CAS Registry Mumber 93776-98-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,7,7 and 6 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 93776-98:
(7*9)+(6*3)+(5*7)+(4*7)+(3*6)+(2*9)+(1*8)=188
188 % 10 = 8
So 93776-98-8 is a valid CAS Registry Number.
InChI:InChI=1/C13H18NO3.CH4O4S/c1-14-6-5-9-7-11(15-2)13(17-4)12(16-3)10(9)8-14;1-5-6(2,3)4/h7-8H,5-6H2,1-4H3;1H3,(H,2,3,4)/q+1;/p-1
