94097-88-8 Usage
Description
(4-Chlorophenyl)(cyclopropyl)methanone O-(4-nitrobenzyl)oxime is a complex organic compound that belongs to the class of substituted aromatic compounds. It features a chlorophenyl group, which imparts aromatic characteristics, a cyclopropyl group that adds to its three-dimensional structure, and a nitrobenzyl oxime functional group composed of an oxime linked to a nitro group. This unique combination of functional groups suggests that the compound may have a variety of potential properties and applications in fields such as organic synthesis or medicinal chemistry. However, further research is necessary to explore and confirm its full potential.
Uses
Used in Organic Synthesis:
(4-Chlorophenyl)(cyclopropyl)methanone O-(4-nitrobenzyl)oxime is used as a key intermediate in the synthesis of various organic compounds. Its unique structure, including the chlorophenyl, cyclopropyl, and nitrobenzyl oxime groups, allows for a range of chemical reactions that can lead to the formation of new molecules with different properties and applications.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, (4-Chlorophenyl)(cyclopropyl)methanone O-(4-nitrobenzyl)oxime may be utilized as a starting material for the development of new pharmaceutical agents. Its structural components could potentially be modified to create molecules with specific biological activities, such as antimicrobial, antiviral, or anticancer properties, depending on the further research and development.
Used in Chemical Research:
(4-Chlorophenyl)(cyclopropyl)methanone O-(4-nitrobenzyl)oxime can also be employed in chemical research to study the reactivity and properties of its constituent functional groups. Understanding how these groups interact with other molecules and under various conditions can provide valuable insights into the design of new chemical processes and the development of novel compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 94097-88-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,4,0,9 and 7 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 94097-88:
(7*9)+(6*4)+(5*0)+(4*9)+(3*7)+(2*8)+(1*8)=168
168 % 10 = 8
So 94097-88-8 is a valid CAS Registry Number.
InChI:InChI=1/C17H15ClN2O3/c18-15-7-5-14(6-8-15)17(13-3-4-13)19-23-11-12-1-9-16(10-2-12)20(21)22/h1-2,5-10,13H,3-4,11H2/b19-17+