94134-26-6 Usage
Heterocyclic organic compound
Contains nitrogen and oxygen atoms in a five-membered ring structure
Versatile chemical
Used in the synthesis of pharmaceuticals and agrochemicals
Potential anti-inflammatory and immunomodulatory properties
Building block in organic synthesis
Valuable intermediate in the production of various compounds
Diverse applications in medicine, agriculture, and chemical engineering
Check Digit Verification of cas no
The CAS Registry Mumber 94134-26-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,4,1,3 and 4 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 94134-26:
(7*9)+(6*4)+(5*1)+(4*3)+(3*4)+(2*2)+(1*6)=126
126 % 10 = 6
So 94134-26-6 is a valid CAS Registry Number.
InChI:InChI=1/C3H4N2O2/c4-3-5-1-2(6)7-3/h1H2,(H2,4,5)