944902-64-1 Usage
General Description
Pyrido[4,3-d]pyrimidine, 4-chloro-5,6,7,8-tetrahydro- is a chemical compound with the molecular formula C9H8ClN3. It is an aromatic heterocyclic compound that contains nitrogen atoms within its structure. This chemical is commonly used in organic synthesis and pharmaceutical research as a building block for the development of novel drugs and therapeutic agents. Its unique structure and properties make it a valuable tool for the exploration of new pharmacological targets and bioactive compounds. Additionally, it may have potential applications in the field of medicinal chemistry for the treatment of various diseases and disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 944902-64-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,4,9,0 and 2 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 944902-64:
(8*9)+(7*4)+(6*4)+(5*9)+(4*0)+(3*2)+(2*6)+(1*4)=191
191 % 10 = 1
So 944902-64-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H8ClN3/c8-7-5-3-9-2-1-6(5)10-4-11-7/h4,9H,1-3H2