947533-21-3 Usage
General Description
2-Acetamidopyridine-5-boronic acid is a chemical compound with a molecular formula of C9H11BN2O3. It is commonly used as a reagent in organic synthesis and pharmaceutical research due to its boronic acid functionality. 2-Acetamidopyridine-5-boronic acid has been found to be a valuable tool in the formation of carbon-carbon and carbon-heteroatom bonds in various chemical reactions. Its boronic acid group allows it to easily bind to other molecules, making it useful in the development of new drugs and materials. Additionally, 2-Acetamidopyridine-5-boronic acid has shown potential as a fluorescent probe for the detection and quantification of biological molecules, making it a versatile and valuable tool in chemical research.
Check Digit Verification of cas no
The CAS Registry Mumber 947533-21-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,7,5,3 and 3 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 947533-21:
(8*9)+(7*4)+(6*7)+(5*5)+(4*3)+(3*3)+(2*2)+(1*1)=193
193 % 10 = 3
So 947533-21-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H9BN2O3/c1-5(11)10-7-3-2-6(4-9-7)8(12)13/h2-4,12-13H,1H3,(H,9,10,11)
