959236-14-7 Usage
Description
7-Fluoroindole-3-acetonitrile is a chemical compound with the molecular formula C10H8FN and a molecular weight of 169.18 g/mol. It is a derivative of indole, featuring a fluorine atom at the 7-position and a cyano group at the 3-position. 7-Fluoroindole-3-acetonitrile is known for its versatile reactivity and is commonly used as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Its unique structural features and valuable building block properties make it an important target for various chemical transformations and functionalization reactions, contributing to its wide range of applications in the synthesis of biologically active molecules.
Uses
Used in Pharmaceutical Synthesis:
7-Fluoroindole-3-acetonitrile is used as an intermediate in the pharmaceutical industry for the synthesis of various biologically active molecules. Its unique structural features and versatile reactivity make it a valuable component in the development of new drugs.
Used in Agrochemical Synthesis:
In the agrochemical industry, 7-Fluoroindole-3-acetonitrile is utilized as an intermediate for the synthesis of agrochemicals. Its properties allow for the creation of compounds with potential applications in crop protection and pest control.
Used in Medicinal Chemistry Research:
7-Fluoroindole-3-acetonitrile is employed as a key chemical in medicinal chemistry research. Its unique structural features and reactivity make it an important target for exploring various chemical transformations and functionalization reactions, contributing to the advancement of drug discovery and development.
Used in Chemical Transformations and Functionalization Reactions:
7-Fluoroindole-3-acetonitrile is used as a building block in chemical transformations and functionalization reactions across various industries. Its unique structural features and versatile reactivity enable the creation of diverse chemical compounds, expanding the scope of chemical synthesis and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 959236-14-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,9,2,3 and 6 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 959236-14:
(8*9)+(7*5)+(6*9)+(5*2)+(4*3)+(3*6)+(2*1)+(1*4)=207
207 % 10 = 7
So 959236-14-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H7FN2/c11-9-3-1-2-8-7(4-5-12)6-13-10(8)9/h1-3,6,13H,4H2