96219-81-7 Usage
Description
2-[(DIMETHYLAMINO)METHYLENE]-3-(2-NAPHTHYL)-3-OXO-PROPANENITRILE is a yellow solid nitrile compound characterized by the presence of a dimethylamino group and a naphthyl group. It is utilized in organic synthesis and has potential applications in pharmaceutical research and development due to its unique structure and possible biological activity. Careful handling and storage are necessary due to its potential hazardous properties.
Uses
Used in Pharmaceutical Research and Development:
2-[(DIMETHYLAMINO)METHYLENE]-3-(2-NAPHTHYL)-3-OXO-PROPANENITRILE is used as a chemical intermediate for the synthesis of various pharmaceutical compounds, leveraging its unique structure and potential biological activity to contribute to the development of new drugs.
Used in Organic Synthesis:
In the field of organic synthesis, 2-[(DIMETHYLAMINO)METHYLENE]-3-(2-NAPHTHYL)-3-OXO-PROPANENITRILE serves as a key component in the creation of complex organic molecules, taking advantage of its reactive groups to form a variety of chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 96219-81-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,6,2,1 and 9 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 96219-81:
(7*9)+(6*6)+(5*2)+(4*1)+(3*9)+(2*8)+(1*1)=157
157 % 10 = 7
So 96219-81-7 is a valid CAS Registry Number.
InChI:InChI=1/C16H14N2O/c1-18(2)11-15(10-17)16(19)14-8-7-12-5-3-4-6-13(12)9-14/h3-9,11H,1-2H3/b15-11+
