98025-62-8 Usage
General Description
(5-Methyl-[1,3,4]thiadiazol-2-yl)-hydrazine is a chemical compound that belongs to the class of thiadiazole derivatives. It is a heterocyclic compound containing a thiadiazole ring and a hydrazine functional group. (5-METHYL-[1,3,4]THIADIAZOL-2-YL)-HYDRAZINE has potential applications in the field of medicinal chemistry due to its diverse biological activities, such as antimicrobial, antifungal, and antiviral properties. It has also been studied for its potential use as a corrosion inhibitor and as a building block in the synthesis of other organic compounds. The exact mechanism of action and specific uses of (5-Methyl-[1,3,4]thiadiazol-2-yl)-hydrazine may vary depending on the specific application and intended use in different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 98025-62-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,8,0,2 and 5 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 98025-62:
(7*9)+(6*8)+(5*0)+(4*2)+(3*5)+(2*6)+(1*2)=148
148 % 10 = 8
So 98025-62-8 is a valid CAS Registry Number.
InChI:InChI=1/C3H6N4S/c1-2-6-7-3(5-4)8-2/h4H2,1H3,(H,5,7)