98027-52-2 Usage
General Description
1-Acetyl-4-iodo-1H-pyrazole is a chemical compound with the molecular formula C5H5IN2O. It is a pyrazole derivative that is typically used in pharmaceutical research and development. The compound is characterized by the presence of an acetyl group and an iodine atom attached to a pyrazole ring. It has potential applications in the synthesis of biologically active molecules and pharmaceutical drugs. The compound may also have other industrial or research uses, such as in the development of new materials or in chemical synthesis processes. Overall, 1-Acetyl-4-iodo-1H-pyrazole is a versatile chemical compound with potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 98027-52-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,8,0,2 and 7 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 98027-52:
(7*9)+(6*8)+(5*0)+(4*2)+(3*7)+(2*5)+(1*2)=152
152 % 10 = 2
So 98027-52-2 is a valid CAS Registry Number.
InChI:InChI=1/C5H5IN2O/c1-4(9)8-3-5(6)2-7-8/h2-3H,1H3
98027-52-2Relevant articles and documents
Histone Deacetylase Inhibitors
-
Paragraph 0479, (2013/12/04)
This invention relates to generally inhibiting histone deacetylase (“HDAC”) enzymes (e.g., HDAC1, HDAC2, and HDAC3).
