98437-23-1 Usage
Description
2-Benzothienylboronic acid is an organic compound that features a benzene ring fused with a thiophene ring, with a boronic acid group attached at the 2-position. It is a white to off-white powder and is known for its unique chemical properties, making it a versatile building block in organic synthesis and medicinal chemistry.
Uses
Used in Pharmaceutical Industry:
2-Benzothienylboronic acid is used as a key intermediate in the synthesis of various pharmaceutical compounds, including D,D-carboxypeptidase R39 inhibitors, PDE4 inhibitors, and CYP11B1 inhibitors. These inhibitors are essential for the development of drugs targeting cortisol-dependent diseases and other therapeutic applications.
Used in Chemical Synthesis:
2-Benzothienylboronic acid is used as a reactant in Suzuki-Miyaura cross-coupling reactions, a widely employed method in organic synthesis for the formation of carbon-carbon bonds. This reaction allows for the efficient construction of complex molecular structures and the development of new materials and compounds.
Used in Biochemistry:
2-Benzothienylboronic acid is used as a chemoselective modification agent for oncolytic adenoviruses, which are engineered viruses that selectively infect and kill cancer cells. This modification enhances the therapeutic potential of these viruses and contributes to the development of novel cancer treatments.
Used in Analytical Chemistry:
2-Benzothienylboronic acid is used in the synthesis of phosphorescent sensors for the quantification of copper(II) ions. These sensors are valuable tools in environmental monitoring, medical diagnostics, and other fields where the detection and measurement of metal ions are crucial.
Used in Organic Synthesis:
2-Benzothienylboronic acid is used as a reactant in UV-promoted phenanthridine syntheses, which are important for the preparation of various organic compounds with potential applications in pharmaceuticals, agrochemicals, and materials science.
Overall, 2-Benzothienylboronic acid is a valuable compound with diverse applications across different industries, including pharmaceuticals, chemical synthesis, biochemistry, analytical chemistry, and organic synthesis. Its unique chemical properties and versatility make it an essential component in the development of new drugs, materials, and technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 98437-23-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,8,4,3 and 7 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 98437-23:
(7*9)+(6*8)+(5*4)+(4*3)+(3*7)+(2*2)+(1*3)=171
171 % 10 = 1
So 98437-23-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H7BO2S/c10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-5,10-11H