98437-41-3 Usage
Description
5-Bromo-2-hydroxy-4-methoxybenzoic acid is a chemical compound with the molecular formula C8H7BrO4. It is a derivative of benzoic acid, containing a bromine, hydroxyl, and methoxy group on the benzene ring. 5-BROMO-2-HYDROXY-4-METHOXYBENZOIC ACID is known for its potential applications in various fields, particularly in the pharmaceutical and agrochemical industries.
Uses
Used in Pharmaceutical Industry:
5-Bromo-2-hydroxy-4-methoxybenzoic acid is used as a building block for the synthesis of pharmaceutical drugs. Its unique structure allows it to be a key component in the development of new chemical compounds with therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical industry, 5-Bromo-2-hydroxy-4-methoxybenzoic acid serves as a precursor in the synthesis of various agrochemical products. Its potential antifungal and antibacterial properties make it a valuable asset in the development of new pesticides and fungicides.
Used as a Reagent:
5-Bromo-2-hydroxy-4-methoxybenzoic acid is commonly used as a reagent in organic synthesis. Its versatility in chemical reactions makes it a popular choice for researchers and chemists working on the synthesis of new compounds.
Used as an Intermediate:
5-BROMO-2-HYDROXY-4-METHOXYBENZOIC ACID also serves as an intermediate in the synthesis of other organic compounds. Its presence in the reaction process can help facilitate the formation of desired products, making it an essential component in many chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 98437-41-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,8,4,3 and 7 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 98437-41:
(7*9)+(6*8)+(5*4)+(4*3)+(3*7)+(2*4)+(1*1)=173
173 % 10 = 3
So 98437-41-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H7BrO4/c1-13-7-3-6(10)4(8(11)12)2-5(7)9/h2-3,10H,1H3,(H,11,12)
98437-41-3Relevant articles and documents
Big catkin willow acids compounds and medical use
-
Paragraph 0125; 0127; 0128, (2019/05/28)
The invention discloses a AMPK agonist activity with salicylic acid compound and its preparation method and medical use, it is the structural formula of the formula (I) compound of formula, its pharmaceutically acceptable salt or prodrug or solvate. The structure of the invention of formula (I) compound of formula activated AMPK, therefore can be used for preparing the prevention or treatment of AMPK mediated diseases.
