166526-03-0 Usage
Description
4,6-Dichloronicotinonitrile is a nitrile organic compound characterized by the presence of a nitrile group (-CN) and two chlorine atoms attached to the 4th and 6th carbon positions of the nicotinonitrile molecule. This unique structure endows it with specific chemical properties that make it a valuable building block in the synthesis of various pharmaceuticals and other organic compounds.
Uses
Used in Pharmaceutical Industry:
4,6-Dichloronicotinonitrile is used as a pharmaceutical intermediate for the synthesis of various drugs and medicinal compounds. Its chemical structure allows for the development of new pharmaceutical agents with potential therapeutic applications, making it an essential component in the discovery and production of novel medications.
As a pharmaceutical intermediate, 4,6-Dichloronicotinonitrile plays a crucial role in the synthesis of drugs that target a wide range of medical conditions. Its versatility in chemical reactions enables the creation of diverse drug candidates with the potential to address unmet medical needs and improve patient outcomes.
Check Digit Verification of cas no
The CAS Registry Mumber 166526-03-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,6,5,2 and 6 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 166526-03:
(8*1)+(7*6)+(6*6)+(5*5)+(4*2)+(3*6)+(2*0)+(1*3)=140
140 % 10 = 0
So 166526-03-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H2Cl2N2/c7-5-1-6(8)10-3-4(5)2-9/h1,3H
166526-03-0Relevant articles and documents
Boron-Containing Small Molecules as Anti-Inflammatory Agents
-
Paragraph 1175, (2015/11/16)
Compounds and methods of treating anti-inflammatory conditions are disclosed.