22804-49-5 Usage
Chemical class
Xanthene derivatives
A compound based on a xanthene core with additional functional groups.
Xanthene core
A central structure consisting of a fused benzene ring system.
Three methoxy substituents
Methoxy groups (-OCH3) attached to the xanthene core, contributing to its chemical properties.
One hydroxy substituent
A hydroxyl group (-OH) attached to the xanthene core, influencing its reactivity and properties.
Fluorescent properties
Known for emitting light upon excitation, making it useful in various applications.
Fluorescent dyes
Utilized in the creation of dyes that exhibit fluorescence.
Imaging techniques
Employed in techniques that rely on the detection of fluorescent signals.
Synthesis of other organic compounds
Serves as a starting material or intermediate in the synthesis of various organic compounds.
Pharmaceutical synthesis
Used in the production of pharmaceuticals due to its versatile chemical structure.
Antioxidant properties
Potential to neutralize harmful free radicals, protecting cells from damage.
Anti-cancer properties
Possibility of inhibiting cancer cell growth or inducing cancer cell death, making it a subject of research for potential cancer treatments.
Chemistry
Involved in the synthesis and study of its chemical properties.
Biology
Studied for its potential biological activities and interactions with biological systems.
Materials science
Utilized in the development of fluorescent materials and imaging techniques.
Check Digit Verification of cas no
The CAS Registry Mumber 22804-49-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,8,0 and 4 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 22804-49:
(7*2)+(6*2)+(5*8)+(4*0)+(3*4)+(2*4)+(1*9)=95
95 % 10 = 5
So 22804-49-5 is a valid CAS Registry Number.
InChI:InChI=1/C16H14O6/c1-19-9-6-4-5-8-13(17)12-10(22-15(8)9)7-11(20-2)16(21-3)14(12)18/h4-7,18H,1-3H3