54561-69-2 Usage
Yellow crystalline solid
The compound has a yellow color and a crystalline structure.
Insoluble in water
The compound does not dissolve in water, which can be important for its chemical properties and applications.
Precursors for organic synthesis
The compound is mainly used as a precursor for the synthesis of various organic compounds, which can be modified or transformed into other molecules.
Sulfur-containing compounds
The compound is commonly used in organic synthesis for the preparation of various sulfur-containing compounds, which can have a range of applications in different fields.
Reagent in chemical reactions
The compound can act as a reagent in chemical reactions, facilitating or promoting certain chemical transformations.
Potent biological activities
The compound is known for its potent biological activities, including anti-cancer and anti-microbial properties, which makes it a key compound in medicinal chemistry research.
Toxic and irritating
The compound can be toxic and irritating to the skin, eyes, and respiratory system if inhaled or absorbed, so it should be handled with care.
Check Digit Verification of cas no
The CAS Registry Mumber 54561-69-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,5,6 and 1 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 54561-69:
(7*5)+(6*4)+(5*5)+(4*6)+(3*1)+(2*6)+(1*9)=132
132 % 10 = 2
So 54561-69-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H8N2S2/c1-14-11(9(7-12)8-13)15-10-5-3-2-4-6-10/h2-6H,1H3
