The CAS register number of 1,3-Dichloro-7-fluoroisoquinoline is 941294-25-3. It also can be called as Isoquinoline,1,3-dichloro-7-fluoro- and the systematic name about this chemical is 1,3-dichloro-7-fluoro-isoquinoline. The molecular formula about this chemical is C₉H₄Cl₂FN and molecular weight is 216.04. It belongs to the following product categories, such as Blocks; Heterocycles; Quinolines and so on.

Physical properties about 1,3-Dichloro-7-fluoroisoquinoline are: (1)ACD/LogP: 3.36; (2)ACD/LogD (pH 5.5): 3.36; (3)ACD/LogD (pH 7.4): 3.36; (4)#H bond acceptors: 1; (5)Polar Surface Area: 12.89Ų; (6)Index of Refraction: 1.636; (7)Molar Refractivity: 51.97 cm³; (8)Molar Volume: 144.8 cm³; (9)Polarizability: 20.6x10^-24cm³; (10)Surface Tension: 49.4 dyne/cm; (11)Enthalpy of Vaporization: 55.22 kJ/mol; (12)Boiling Point: 332.3 °C at 760 mmHg; (13)Vapour Pressure: 0.000285 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: c1cc(cc2c1cc(nc2Cl)Cl)F
(2)InChI: InChI=1/C9H4Cl2FN/c10-8-3-5-1-2-6(12)4-7(5)9(11)13-8/h1-4H
(3)InChIKey: RPCBWABYLPCEQX-UHFFFAOYAO
(4)Std. InChI: InChI=1S/C9H4Cl2FN/c10-8-3-5-1-2-6(12)4-7(5)9(11)13-8/h1-4H
(5)Std. InChIKey: RPCBWABYLPCEQX-UHFFFAOYSA-N