941294-25-3 Usage
Description
1,3-Dichloro-7-fluoroisoquinoline is an organic compound that features a unique structure with two chlorine atoms at the 1 and 3 positions and a fluorine atom at the 7 position on the isoquinoline ring. 1,3-Dichloro-7-fluoroisoquinoline is known for its potential applications in the synthesis of various organic molecules and pharmaceuticals.
Uses
Used in Pharmaceutical Industry:
1,3-Dichloro-7-fluoroisoquinoline is used as a key reactant for the preparation of chiral 1,2,3,4-tetrahydroisoquinolines (THIQs). These THIQs are important intermediates in the synthesis of various pharmaceutical compounds, including those with potential therapeutic applications.
Used in Organic Synthesis:
In the field of organic synthesis, 1,3-dichloro-7-fluoroisoquinoline serves as a versatile building block for the creation of a wide range of organic molecules. Its unique structure allows for various chemical reactions, enabling the development of new compounds with diverse properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 941294-25-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,1,2,9 and 4 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 941294-25:
(8*9)+(7*4)+(6*1)+(5*2)+(4*9)+(3*4)+(2*2)+(1*5)=173
173 % 10 = 3
So 941294-25-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H4Cl2FN/c10-8-3-5-1-2-6(12)4-7(5)9(11)13-8/h1-4H
941294-25-3Relevant articles and documents
GLYCOLATE OXIDASE INHIBITORS FOR THE TREATMENT OF DISEASE
-
Paragraph 001235; 001237, (2021/01/22)
Described herein are compounds, methods of making such compounds, pharmaceutical compositions and medicaments containing such compounds, and methods of using such compounds to treat or prevent diseases or disorders associated with a defect in glyoxylate metabolism, for example a disease or disorder associated with the enzyme glycolate oxidase (GO) or alterations in oxalate metabolism. Such diseases or disorders include, for example, disorders of glyoxylate metabolism, including primary hyperoxaluria, that are associated with production of excessive amounts of oxalate.