The 1-Propene, 2-methyl-,tetramer, with the CAS registry number 15220-85-6, is also known as Nonane, 2,2,4,4,6,6,8-heptamethyl-. This chemical's molecular formula is C₁₆H₃₄ and molecular weight is 226.44116. Its IUPAC name is called 2,2,4,4,6,6,8-heptamethylnonane.

Physical properties of 1-Propene, 2-methyl-,tetramer: (1)ACD/LogP: 7.98; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): 7.98; (4)ACD/LogD (pH 7.4): 7.98; (5)ACD/BCF (pH 5.5): 678487; (6)ACD/BCF (pH 7.4): 678487; (7)ACD/KOC (pH 5.5): 519742.09; (8)ACD/KOC (pH 7.4): 519742.09; (9)#Freely Rotating Bonds: 6; (10)Index of Refraction: 1.431; (11)Molar Refractivity: 76.03 cm³; (12)Molar Volume: 293.1 cm³; (13)Surface Tension: 24.3 dyne/cm; (14)Density: 0.772 g/cm³; (15)Flash Point: 110.2 °C; (16)Enthalpy of Vaporization: 47.59 kJ/mol; (17)Boiling Point: 258.3 °C at 760 mmHg; (18)Vapour Pressure: 0.0223 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CC(C)CC(C)(C)CC(C)(C)CC(C)(C)C
(2)InChI: InChI=1S/C16H34/c1-13(2)10-15(6,7)12-16(8,9)11-14(3,4)5/h13H,10-12H2,1-9H3
(3)InChIKey: RDUBCTHNBWFPTP-UHFFFAOYSA-N