The 1H-3-Benzazepine, 2, 3, 4, 5-tetrahydro-, with the CAS registry number of 4424-20-8, is also known as 2, 3, 4, 5-Tetrahydro-1H-benzo[d]azepine. This chemical's molecular formula is C₁₀H₁₃N and molecular weight is 147.22. What's more, its IUPAC name is 2, 3, 4, 5-Tetrahydro-1H-3-benzazepine.

Physical properties about 1H-3-Benzazepine, 2, 3, 4, 5-tetrahydro- are: (1)ACD/LogP: 1.81; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -1.29; (4)ACD/LogD (pH 7.4): -0.87; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 1; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 3.24 Å²; (13)Index of Refraction: 1.53; (14)Molar Refractivity: 46.38 cm³; (15)Molar Volume: 150 cm³; (16)Surface Tension: 35.5 dyne/cm; (17)Density: 0.981 g/cm³; (18)Flash Point: 114.9 °C; (19)Enthalpy of Vaporization: 49.64 kJ/mol; (20)Boiling Point: 258.8 °C at 760 mmHg; (21)Vapour Pressure: 0.0135 mmHg at 25 °C.

Preparation: this chemical is prepared by 3, 4-Dihydro-2H-naphthalen-1-one oxime. The reaction needs reagent Diisobutyl aluminium hydride and solvent CH₂Cl₂. The reaction time is 1 hours with reaction temperature of 0 °C. The yield is about 92 %.

Uses: it is used to produce other chemicals. For example, it is used to produce 1-Methyl-2, 3, 4, 5-tetrahydro-1H-benzo[b]azepine. This reaction needs reagent n-Butyllithium. Meanwhile, it needs solvents Tetrahydrofuran and Hexane. Other conditions of this reaction are 1.)THF, Hexane, 0 °C; 2.)12 h, r.t..The yield is about 60 %.

You can still convert the following datas into molecular structure:
(1) SMILES: c1cc2c(cc1)CCNCC2
(2) InChI: InChI=1/C10H13N/c1-2-4-10-6-8-11-7-5-9(10)3-1/h1-4,11H,5-8H2
(3) InChIKey: MWVMYAWMFTVYED-UHFFFAOYAW