The 2,4-Dichloro-7-iodoquinazoline with CAS registry number of 959237-34-4 is also known as Quinazoline, 2,4-dichloro-7-iodo-. The IUPAC name and product name are the same. In addition, the formula is C₈H₃Cl₂IN₂ and the molecular weight is 324.93.

Physical properties about 2,4-Dichloro-7-iodoquinazoline are: (1)ACD/LogP: 3.78; (2)ACD/LogD (pH 5.5): 3.78; (3)ACD/LogD (pH 7.4): 3.78; (4)ACD/BCF (pH 5.5): 436.75; (5)ACD/BCF (pH 7.4): 436.75; (6)ACD/KOC (pH 5.5): 2700.74; (7)ACD/KOC (pH 7.4): 2700.74; (8)#H bond acceptors: 2; (9)Index of Refraction: 1.741; (10)Molar Refractivity: 62.97 cm³; (11)Molar Volume: 155.9 cm³; (12)Surface Tension: 67.3 dyne/cm; (13)Density: 2.083 g/cm³; (14)Flash Point: 122.7 °C; (15)Enthalpy of Vaporization: 49.71 kJ/mol; (16)Boiling Point: 279.2 °C at 760 mmHg; (17)Vapour Pressure: 0.00689 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
1. Canonical SMILES: C1=CC2=C(C=C1I)N=C(N=C2Cl)Cl
2. InChI: InChI=1S/C8H3Cl2IN2/c9-7-5-2-1-4(11)3-6(5)12-8(10)13-7/h1-3H
3. InChIKey: OAZYTNLOQKCMDG-UHFFFAOYSA-N