The 2,5-Dimethylphenylacetyl chloride, with the CAS registry number 55312-97-5, is also known as Benzeneacetyl chloride, 2,5-dimethyl-. This chemical's molecular formula is C₁₀H₁₁ClO and molecular weight is 182.6467. Its systematic name is called (2,5-dimethylphenyl)acetyl chloride.

Physical properties of 2,5-Dimethylphenylacetyl chloride: (1)ACD/LogP: 2.62; (2)ACD/LogD (pH 5.5): 3; (3)ACD/LogD (pH 7.4): 3; (4)ACD/BCF (pH 5.5): 147; (5)ACD/BCF (pH 7.4): 147; (6)ACD/KOC (pH 5.5): 1238; (7)ACD/KOC (pH 7.4): 1238; (8)#H bond acceptors: 1; (9)#Freely Rotating Bonds: 2; (10)Index of Refraction: 1.529; (11)Molar Refractivity: 50.331 cm³; (12)Molar Volume: 163.305 cm³; (13)Surface Tension: 36.963 dyne/cm; (14)Density: 1.118 g/cm³; (15)Flash Point: 113.995 °C; (16)Enthalpy of Vaporization: 49.796 kJ/mol; (17)Boiling Point: 260.272 °C at 760 mmHg; (18)Vapour Pressure: 0.012 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(Cl)Cc1cc(C)ccc1C
(2)InChI: InChI=1/C10H11ClO/c1-7-3-4-8(2)9(5-7)6-10(11)12/h3-5H,6H2,1-2H3
(3)InChIKey: PZRANTBLOIKHJY-UHFFFAOYAA