The 2-Butenedioic acid(2Z)-, diammonium salt (9CI), with the CAS registry number 23705-99-9, is also known as 2-Butenedioic acid, ammonium salt, (2Z)-. Its EINECS registry number is 245-835-3. This chemical's molecular formula is C₄H₁₀N₂O₄ and molecular weight is 150.1332. Its systematic name is called diammonium (Z)-but-2-enedioate.

Physical properties of 2-Butenedioic acid(2Z)-, diammonium salt (9CI): (1)ACD/LogP: -0.01; (2)ACD/LogD (pH 5.5): -3; (3)ACD/LogD (pH 7.4): -5; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 4; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 2; (11)Flash Point: 183 °C; (12)Enthalpy of Vaporization: 65.99 kJ/mol; (13)Boiling Point: 355.5 °C at 760 mmHg; (14)Vapour Pressure: 5.19E-06 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: C(=CC(=O)[O-])C(=O)[O-].[NH4+].[NH4+]
(2)InChI: InChI=1/C4H4O4.2H3N/c5-3(6)1-2-4(7)8;;/h1-2H,(H,5,6)(H,7,8);2*1H3/b2-1-
(3)InChIKey: CKKXWJDFFQPBQL-UAIGNFCEBM