The 2-Piperidinone,3-hydroxy-, with the CAS registry number 19365-08-3, is also known as 2-Hydroxyvalerolactam. This chemical's molecular formula is C₅H₉NO₂ and molecular weight is 115.1305. What's more, its systematic name and its IUPAC name are the same which is called 3-Hydroxypiperidin-2-one.

Physical properties about 2-Piperidinone,3-hydroxy-: (1)ACD/LogP: -2.26; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1.41; (6)ACD/KOC (pH 7.4): 1.41; (7)#H bond acceptors: 3; (8)#H bond donors: 2; (9)#Freely Rotating Bonds: 1; (10)Polar Surface Area: 29.54 Å²; (11)Index of Refraction: 1.497; (12)Molar Refractivity: 28.12 cm³; (13)Molar Volume: 95.9 cm³; (14)Surface Tension: 45.3 dyne/cm; (15)Density: 1.199 g/cm³; (16)Flash Point: 166.8 °C; (17)Enthalpy of Vaporization: 69.13 kJ/mol; (18)Boiling Point: 352.3 °C at 760 mmHg; (19)Vapour Pressure: 2.28E-06 mmHg at 25 °C.

Uses of 2-Piperidinone,3-hydroxy-: it is used to produce other chemicals. For example, it is used to produce 5,6,7,8-Tetrahydro-imidazo[1,2-α]pyridin-8-ol. The reaction occurs with catalyzer TiCl₄ and reagent 1,3,5-Trimethyl-benzene heating for 72 hours. The yield is 61 %.



You can still convert the following datas into molecular structure:
(1) SMILES: O=C1NCCCC1O
(2) InChI: InChI=1/C5H9NO2/c7-4-2-1-3-6-5(4)8/h4,7H,1-3H2,(H,6,8)
(3) InChIKey: RYKLZUPYJFFNRR-UHFFFAOYAN